C20H23N5O5 — CID 70490672
(2R,3S,4R,5R)-2-(hydroxymethyl)-5-[6-[(5-methoxy-2,3-dihydro-1H-inden-1-yl)amino]purin-9-yl]oxolane-3,4-diol (PubChem CID 70490672) has the molecular formula C20H23N5O5 and a molecular weight of 413.43 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2-(hydroxymethyl)-5-[6-[(5-methoxy-2,3-dihydro-1H-inden-1-yl)amino]purin-9-yl]oxolane-3,4-diol.
| Compound Name | (2R,3S,4R,5R)-2-(hydroxymethyl)-5-[6-[(5-methoxy-2,3-dihydro-1H-inden-1-yl)amino]purin-9-yl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 70490672 |
| Molecular Formula | C20H23N5O5 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | (2R,3S,4R,5R)-2-(hydroxymethyl)-5-[6-[(5-methoxy-2,3-dihydro-1H-inden-1-yl)amino]purin-9-yl]oxolane-3,4-diol |
| SMILES | COc1ccc2c(c1)CCC2Nc1ncnc2c1ncn2[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C20H23N5O5/c1-29-11-3-4-12-10(6-11)2-5-13(12)24-18-15-19(22-8-21-18)25(9-23-15)20-17(28)16(27)14(7-26)30-20/h3-4,6,8-9,13-14,16-17,20,26-28H,2,5,7H2,1H3,(H,21,22,24)/t13?,14-,16-,17-,20-/m1/s1 |
| InChIKey | ITGWXDBMFNCXMU-UEXBNONGSA-N |
| XLogP | 0.55 |
| TPSA | 134.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |