C21H27NO3 — CID 70490711
2-(3,17-dimethoxy-16-azatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),2(7),9,11,14(18)-pentaen-5-yl)ethanol (PubChem CID 70490711) has the molecular formula C21H27NO3 and a molecular weight of 341.45 g/mol. Its IUPAC name is 2-(3,17-dimethoxy-16-azatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),2(7),9,11,14(18)-pentaen-5-yl)ethanol.
| Compound Name | 2-(3,17-dimethoxy-16-azatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),2(7),9,11,14(18)-pentaen-5-yl)ethanol |
|---|---|
| PubChem CID | 70490711 |
| Molecular Formula | C21H27NO3 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | 2-(3,17-dimethoxy-16-azatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),2(7),9,11,14(18)-pentaen-5-yl)ethanol |
| SMILES | COC1=C2C3=C(CC=CC3=CCC3=C2C(OC)CC(CCO)C3)CN1 |
| InChI | InChI=1S/C21H27NO3/c1-24-17-11-13(8-9-23)10-15-7-6-14-4-3-5-16-12-22-21(25-2)20(18(14)16)19(15)17/h3-4,6,13,17,22-23H,5,7-12H2,1-2H3 |
| InChIKey | HEBUWFXLUFTRNK-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |