C11H18N2S — CID 70490890
2-(2,3,3a,4,5,7a-hexahydro-1H-indol-3-yl)-1,3-thiazolidine (PubChem CID 70490890) has the molecular formula C11H18N2S and a molecular weight of 210.35 g/mol. Its IUPAC name is 2-(2,3,3a,4,5,7a-hexahydro-1H-indol-3-yl)-1,3-thiazolidine.
| Compound Name | 2-(2,3,3a,4,5,7a-hexahydro-1H-indol-3-yl)-1,3-thiazolidine |
|---|---|
| PubChem CID | 70490890 |
| Molecular Formula | C11H18N2S |
| Molecular Weight | 210.35 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | 2-(2,3,3a,4,5,7a-hexahydro-1H-indol-3-yl)-1,3-thiazolidine |
| SMILES | C1=CC2NCC(C3NCCS3)C2CC1 |
| InChI | InChI=1S/C11H18N2S/c1-2-4-10-8(3-1)9(7-13-10)11-12-5-6-14-11/h2,4,8-13H,1,3,5-7H2 |
| InChIKey | DRRIIXVGURWPIY-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.35 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|