C18H21NO2 — CID 70490916
5-methyl-16-azatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),2(7),9,11,14(18)-pentaene-3,17-diol (PubChem CID 70490916) has the molecular formula C18H21NO2 and a molecular weight of 283.37 g/mol. Its IUPAC name is 5-methyl-16-azatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),2(7),9,11,14(18)-pentaene-3,17-diol.
| Compound Name | 5-methyl-16-azatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),2(7),9,11,14(18)-pentaene-3,17-diol |
|---|---|
| PubChem CID | 70490916 |
| Molecular Formula | C18H21NO2 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | 5-methyl-16-azatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),2(7),9,11,14(18)-pentaene-3,17-diol |
| SMILES | CC1CC2=C(C3=C(O)NCC4=C3C(=CC2)C=CC4)C(O)C1 |
| InChI | InChI=1S/C18H21NO2/c1-10-7-12-6-5-11-3-2-4-13-9-19-18(21)17(15(11)13)16(12)14(20)8-10/h2-3,5,10,14,19-21H,4,6-9H2,1H3 |
| InChIKey | BASACHLSQZLOQQ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |