C19H23NO3 — CID 70490927
5-(2-hydroxyethyl)-16-azatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),2(7),9,11,14(18)-pentaene-3,17-diol (PubChem CID 70490927) has the molecular formula C19H23NO3 and a molecular weight of 313.40 g/mol. Its IUPAC name is 5-(2-hydroxyethyl)-16-azatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),2(7),9,11,14(18)-pentaene-3,17-diol.
| Compound Name | 5-(2-hydroxyethyl)-16-azatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),2(7),9,11,14(18)-pentaene-3,17-diol |
|---|---|
| PubChem CID | 70490927 |
| Molecular Formula | C19H23NO3 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | 5-(2-hydroxyethyl)-16-azatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),2(7),9,11,14(18)-pentaene-3,17-diol |
| SMILES | OCCC1CC2=C(C3=C(O)NCC4=C3C(=CC2)C=CC4)C(O)C1 |
| InChI | InChI=1S/C19H23NO3/c21-7-6-11-8-13-5-4-12-2-1-3-14-10-20-19(23)18(16(12)14)17(13)15(22)9-11/h1-2,4,11,15,20-23H,3,5-10H2 |
| InChIKey | MCXPNWNARSZSGD-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |