C19H27FO2 — CID 70491539
2-ethyl-6-[(2-fluorophenyl)methoxy]-2-methyl-1-oxaspiro[4.5]decane (PubChem CID 70491539) has the molecular formula C19H27FO2 and a molecular weight of 306.42 g/mol. Its IUPAC name is 2-ethyl-6-[(2-fluorophenyl)methoxy]-2-methyl-1-oxaspiro[4.5]decane.
| Compound Name | 2-ethyl-6-[(2-fluorophenyl)methoxy]-2-methyl-1-oxaspiro[4.5]decane |
|---|---|
| PubChem CID | 70491539 |
| Molecular Formula | C19H27FO2 |
| Molecular Weight | 306.42 g/mol |
| Exact Mass | 306.20 |
| IUPAC Name | 2-ethyl-6-[(2-fluorophenyl)methoxy]-2-methyl-1-oxaspiro[4.5]decane |
| SMILES | CCC1(C)CCC2(CCCCC2OCc2ccccc2F)O1 |
| InChI | InChI=1S/C19H27FO2/c1-3-18(2)12-13-19(22-18)11-7-6-10-17(19)21-14-15-8-4-5-9-16(15)20/h4-5,8-9,17H,3,6-7,10-14H2,1-2H3 |
| InChIKey | XNLSATJUAATHRS-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.42 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |