C22H29NO2 — CID 70491789
3,17-dimethoxy-5-propyl-16-azatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),2(7),9,11,14(18)-pentaene (PubChem CID 70491789) has the molecular formula C22H29NO2 and a molecular weight of 339.48 g/mol. Its IUPAC name is 3,17-dimethoxy-5-propyl-16-azatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),2(7),9,11,14(18)-pentaene.
| Compound Name | 3,17-dimethoxy-5-propyl-16-azatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),2(7),9,11,14(18)-pentaene |
|---|---|
| PubChem CID | 70491789 |
| Molecular Formula | C22H29NO2 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.22 |
| IUPAC Name | 3,17-dimethoxy-5-propyl-16-azatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),2(7),9,11,14(18)-pentaene |
| SMILES | CCCC1CC2=C(C3=C(OC)NCC4=C3C(=CC2)C=CC4)C(OC)C1 |
| InChI | InChI=1S/C22H29NO2/c1-4-6-14-11-16-10-9-15-7-5-8-17-13-23-22(25-3)21(19(15)17)20(16)18(12-14)24-2/h5,7,9,14,18,23H,4,6,8,10-13H2,1-3H3 |
| InChIKey | XZANUOVEQILABB-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |