C18H30O4 — CID 70492399
2-[[3-[1-(2-methoxyethoxy)ethyl]-1,2,3,3a,4,6a-hexahydropentalen-2-yl]oxy]oxane (PubChem CID 70492399) has the molecular formula C18H30O4 and a molecular weight of 310.43 g/mol. Its IUPAC name is 2-[[3-[1-(2-methoxyethoxy)ethyl]-1,2,3,3a,4,6a-hexahydropentalen-2-yl]oxy]oxane.
| Compound Name | 2-[[3-[1-(2-methoxyethoxy)ethyl]-1,2,3,3a,4,6a-hexahydropentalen-2-yl]oxy]oxane |
|---|---|
| PubChem CID | 70492399 |
| Molecular Formula | C18H30O4 |
| Molecular Weight | 310.43 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | 2-[[3-[1-(2-methoxyethoxy)ethyl]-1,2,3,3a,4,6a-hexahydropentalen-2-yl]oxy]oxane |
| SMILES | COCCOC(C)C1C(OC2CCCCO2)CC2C=CCC21 |
| InChI | InChI=1S/C18H30O4/c1-13(20-11-10-19-2)18-15-7-5-6-14(15)12-16(18)22-17-8-3-4-9-21-17/h5-6,13-18H,3-4,7-12H2,1-2H3 |
| InChIKey | FSVUOIXXIRLQCT-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.43 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|