About 2-pentyl-5H-1,3-benzothiazol-4-one
2-pentyl-5H-1,3-benzothiazol-4-one (PubChem CID 70492419) has the molecular formula C12H15NOS
and a molecular weight of 221.32 g/mol. Its IUPAC name is 2-pentyl-5H-1,3-benzothiazol-4-one.
Molecular Properties
| Compound Name | 2-pentyl-5H-1,3-benzothiazol-4-one |
| PubChem CID | 70492419 |
| Molecular Formula | C12H15NOS |
| Molecular Weight | 221.32 g/mol |
| Exact Mass | 221.09 |
| IUPAC Name | 2-pentyl-5H-1,3-benzothiazol-4-one |
| SMILES | CCCCCc1nc2c(s1)C=CCC2=O |
| InChI | InChI=1S/C12H15NOS/c1-2-3-4-8-11-13-12-9(14)6-5-7-10(12)15-11/h5,7H,2-4,6,8H2,1H3 |
| InChIKey | JYOBIINXLSBVME-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.32 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-pentyl-5H-1,3-benzothiazol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pentyl-5H-1,3-benzothiazol-4-one?
The IUPAC name of 2-pentyl-5H-1,3-benzothiazol-4-one (CID 70492419) is 2-pentyl-5H-1,3-benzothiazol-4-one.
What is the SMILES notation for 2-pentyl-5H-1,3-benzothiazol-4-one?
The canonical SMILES for 2-pentyl-5H-1,3-benzothiazol-4-one is CCCCCc1nc2c(s1)C=CCC2=O.
What is the InChIKey of 2-pentyl-5H-1,3-benzothiazol-4-one?
The InChIKey is JYOBIINXLSBVME-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NOS/c1-2-3-4-8-11-13-12-9(14)6-5-7-10(12)15-11/h5,7H,2-4,6,8H2,1H3.
What are the key properties of 2-pentyl-5H-1,3-benzothiazol-4-one?
2-pentyl-5H-1,3-benzothiazol-4-one has a molecular weight of 221.32 g/mol, XLogP of 3.48, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pentyl-5H-1,3-benzothiazol-4-one is sourced from PubChem (CID 70492419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).