C23H22F3NO4 — CID 70492594
2,2,2-trifluoroethyl 2-[2,6-di(propan-2-yl)phenyl]-1,3-dioxoisoindole-4-carboxylate (PubChem CID 70492594) has the molecular formula C23H22F3NO4 and a molecular weight of 433.43 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 2-[2,6-di(propan-2-yl)phenyl]-1,3-dioxoisoindole-4-carboxylate.
| Compound Name | 2,2,2-trifluoroethyl 2-[2,6-di(propan-2-yl)phenyl]-1,3-dioxoisoindole-4-carboxylate |
|---|---|
| PubChem CID | 70492594 |
| Molecular Formula | C23H22F3NO4 |
| Molecular Weight | 433.43 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | 2,2,2-trifluoroethyl 2-[2,6-di(propan-2-yl)phenyl]-1,3-dioxoisoindole-4-carboxylate |
| SMILES | CC(C)c1cccc(C(C)C)c1N1C(=O)c2cccc(C(=O)OCC(F)(F)F)c2C1=O |
| InChI | InChI=1S/C23H22F3NO4/c1-12(2)14-7-5-8-15(13(3)4)19(14)27-20(28)16-9-6-10-17(18(16)21(27)29)22(30)31-11-23(24,25)26/h5-10,12-13H,11H2,1-4H3 |
| InChIKey | IMCWFCHKVRJNCY-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.43 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|