C22H36O5S — CID 70492648
2-[2-[(3aR,4S,5S,6aS)-4-(5-cyclopentyloxy-3-hydroxypent-1-enyl)-5-hydroxy-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]ethylsulfanyl]acetic acid (PubChem CID 70492648) has the molecular formula C22H36O5S and a molecular weight of 412.59 g/mol. Its IUPAC name is 2-[2-[(3aR,4S,5S,6aS)-4-(5-cyclopentyloxy-3-hydroxypent-1-enyl)-5-hydroxy-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]ethylsulfanyl]acetic acid.
| Compound Name | 2-[2-[(3aR,4S,5S,6aS)-4-(5-cyclopentyloxy-3-hydroxypent-1-enyl)-5-hydroxy-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]ethylsulfanyl]acetic acid |
|---|---|
| PubChem CID | 70492648 |
| Molecular Formula | C22H36O5S |
| Molecular Weight | 412.59 g/mol |
| Exact Mass | 412.23 |
| IUPAC Name | 2-[2-[(3aR,4S,5S,6aS)-4-(5-cyclopentyloxy-3-hydroxypent-1-enyl)-5-hydroxy-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]ethylsulfanyl]acetic acid |
| SMILES | O=C(O)CSCCC1C[C@H]2C[C@H](O)[C@@H](C=CC(O)CCOC3CCCC3)[C@@H]2C1 |
| InChI | InChI=1S/C22H36O5S/c23-17(7-9-27-18-3-1-2-4-18)5-6-19-20-12-15(8-10-28-14-22(25)26)11-16(20)13-21(19)24/h5-6,15-21,23-24H,1-4,7-14H2,(H,25,26)/t15?,16-,17?,19-,20+,21-/m0/s1 |
| InChIKey | QBXLSULPTNBBBE-IMPNGBMUSA-N |
| XLogP | 3.48 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.59 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|