C24H26F2N4O6 — CID 7049286
(3R,4R,5R)-N-[(2S)-1-amino-3-(4-methoxyphenyl)-1-oxopropan-2-yl]-3-[(2,4-difluorophenyl)carbamoylamino]-4,5-dihydroxycyclohexene-1-carboxamide (PubChem CID 7049286) has the molecular formula C24H26F2N4O6 and a molecular weight of 504.49 g/mol. Its IUPAC name is (3R,4R,5R)-N-[(2S)-1-amino-3-(4-methoxyphenyl)-1-oxopropan-2-yl]-3-[(2,4-difluorophenyl)carbamoylamino]-4,5-dihydroxycyclohexene-1-carboxamide.
| Compound Name | (3R,4R,5R)-N-[(2S)-1-amino-3-(4-methoxyphenyl)-1-oxopropan-2-yl]-3-[(2,4-difluorophenyl)carbamoylamino]-4,5-dihydroxycyclohexene-1-carboxamide |
|---|---|
| PubChem CID | 7049286 |
| Molecular Formula | C24H26F2N4O6 |
| Molecular Weight | 504.49 g/mol |
| Exact Mass | 504.18 |
| IUPAC Name | (3R,4R,5R)-N-[(2S)-1-amino-3-(4-methoxyphenyl)-1-oxopropan-2-yl]-3-[(2,4-difluorophenyl)carbamoylamino]-4,5-dihydroxycyclohexene-1-carboxamide |
| SMILES | COc1ccc(C[C@H](NC(=O)C2=C[C@@H](NC(=O)Nc3ccc(F)cc3F)[C@@H](O)[C@H](O)C2)C(N)=O)cc1 |
| InChI | InChI=1S/C24H26F2N4O6/c1-36-15-5-2-12(3-6-15)8-19(22(27)33)28-23(34)13-9-18(21(32)20(31)10-13)30-24(35)29-17-7-4-14(25)11-16(17)26/h2-7,9,11,18-21,31-32H,8,10H2,1H3,(H2,27,33)(H,28,34)(H2,29,30,35)/t18-,19+,20-,21-/m1/s1 |
| InChIKey | XEGBNLPPENYPSC-PLACYPQZSA-N |
| XLogP | 0.73 |
| TPSA | 163.01 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.49 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |