C19H25ClN4 — CID 70493115
5-hexyl-2,3-diphenyl-1H-tetrazol-1-ium chloride (PubChem CID 70493115) has the molecular formula C19H25ClN4 and a molecular weight of 344.89 g/mol. Its IUPAC name is 5-hexyl-2,3-diphenyl-1H-tetrazol-1-ium chloride.
| Compound Name | 5-hexyl-2,3-diphenyl-1H-tetrazol-1-ium chloride |
|---|---|
| PubChem CID | 70493115 |
| Molecular Formula | C19H25ClN4 |
| Molecular Weight | 344.89 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | 5-hexyl-2,3-diphenyl-1H-tetrazol-1-ium chloride |
| SMILES | CCCCCCC1=NN(c2ccccc2)N(c2ccccc2)[NH2+]1.[Cl-] |
| InChI | InChI=1S/C19H24N4.ClH/c1-2-3-4-11-16-19-20-22(17-12-7-5-8-13-17)23(21-19)18-14-9-6-10-15-18;/h5-10,12-15H,2-4,11,16H2,1H3,(H,20,21);1H |
| InChIKey | UOSGISDWERJLNR-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 35.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.89 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|