About (2S)-2-amino-3-methylbutanoic acid;3-oxabicyclo[3.3.1]nona-1(8),5(9),6-trien-2-one
(2S)-2-amino-3-methylbutanoic acid;3-oxabicyclo[3.3.1]nona-1(8),5(9),6-trien-2-one (PubChem CID 70493497) has the molecular formula C13H17NO4
and a molecular weight of 251.28 g/mol. Its IUPAC name is (2S)-2-amino-3-methylbutanoic acid;3-oxabicyclo[3.3.1]nona-1(8),5(9),6-trien-2-one.
Molecular Properties
| Compound Name | (2S)-2-amino-3-methylbutanoic acid;3-oxabicyclo[3.3.1]nona-1(8),5(9),6-trien-2-one |
| PubChem CID | 70493497 |
| Molecular Formula | C13H17NO4 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | (2S)-2-amino-3-methylbutanoic acid;3-oxabicyclo[3.3.1]nona-1(8),5(9),6-trien-2-one |
| SMILES | CC(C)[C@H](N)C(=O)O.O=C1OCc2cccc1c2 |
| InChI | InChI=1S/C8H6O2.C5H11NO2/c9-8-7-3-1-2-6(4-7)5-10-8;1-3(2)4(6)5(7)8/h1-4H,5H2;3-4H,6H2,1-2H3,(H,7,8)/t;4-/m.0/s1 |
| InChIKey | PLMALWBCYLBMPH-VWMHFEHESA-N |
| XLogP | 1.41 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2S)-2-amino-3-methylbutanoic acid;3-oxabicyclo[3.3.1]nona-1(8),5(9),6-trien-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-amino-3-methylbutanoic acid;3-oxabicyclo[3.3.1]nona-1(8),5(9),6-trien-2-one?
The IUPAC name of (2S)-2-amino-3-methylbutanoic acid;3-oxabicyclo[3.3.1]nona-1(8),5(9),6-trien-2-one (CID 70493497) is (2S)-2-amino-3-methylbutanoic acid;3-oxabicyclo[3.3.1]nona-1(8),5(9),6-trien-2-one.
What is the SMILES notation for (2S)-2-amino-3-methylbutanoic acid;3-oxabicyclo[3.3.1]nona-1(8),5(9),6-trien-2-one?
The canonical SMILES for (2S)-2-amino-3-methylbutanoic acid;3-oxabicyclo[3.3.1]nona-1(8),5(9),6-trien-2-one is CC(C)[C@H](N)C(=O)O.O=C1OCc2cccc1c2.
What is the InChIKey of (2S)-2-amino-3-methylbutanoic acid;3-oxabicyclo[3.3.1]nona-1(8),5(9),6-trien-2-one?
The InChIKey is PLMALWBCYLBMPH-VWMHFEHESA-N. The full InChI is InChI=1S/C8H6O2.C5H11NO2/c9-8-7-3-1-2-6(4-7)5-10-8;1-3(2)4(6)5(7)8/h1-4H,5H2;3-4H,6H2,1-2H3,(H,7,8)/t;4-/m.0/s1.
What are the key properties of (2S)-2-amino-3-methylbutanoic acid;3-oxabicyclo[3.3.1]nona-1(8),5(9),6-trien-2-one?
(2S)-2-amino-3-methylbutanoic acid;3-oxabicyclo[3.3.1]nona-1(8),5(9),6-trien-2-one has a molecular weight of 251.28 g/mol, XLogP of 1.41, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-amino-3-methylbutanoic acid;3-oxabicyclo[3.3.1]nona-1(8),5(9),6-trien-2-one is sourced from PubChem (CID 70493497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).