C26H31N3O3 — CID 70493855
2-[2,6-di(propan-2-yl)phenyl]-1,3-dioxo-N-piperidin-1-ylisoindole-4-carboxamide (PubChem CID 70493855) has the molecular formula C26H31N3O3 and a molecular weight of 433.55 g/mol. Its IUPAC name is 2-[2,6-di(propan-2-yl)phenyl]-1,3-dioxo-N-piperidin-1-ylisoindole-4-carboxamide.
| Compound Name | 2-[2,6-di(propan-2-yl)phenyl]-1,3-dioxo-N-piperidin-1-ylisoindole-4-carboxamide |
|---|---|
| PubChem CID | 70493855 |
| Molecular Formula | C26H31N3O3 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.24 |
| IUPAC Name | 2-[2,6-di(propan-2-yl)phenyl]-1,3-dioxo-N-piperidin-1-ylisoindole-4-carboxamide |
| SMILES | CC(C)c1cccc(C(C)C)c1N1C(=O)c2cccc(C(=O)NN3CCCCC3)c2C1=O |
| InChI | InChI=1S/C26H31N3O3/c1-16(2)18-10-8-11-19(17(3)4)23(18)29-25(31)21-13-9-12-20(22(21)26(29)32)24(30)27-28-14-6-5-7-15-28/h8-13,16-17H,5-7,14-15H2,1-4H3,(H,27,30) |
| InChIKey | GBNPKBWCPZIXDJ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|