C42H56N2O2S4 — CID 70494392
2,5-bis(2-butyloctyl)-1,4-bis(thieno[3,2-b]thiophen-5-yl)pyrrolo[3,4-c]pyrrole-3,6-dione (PubChem CID 70494392) has the molecular formula C42H56N2O2S4 and a molecular weight of 749.19 g/mol. Its IUPAC name is 2,5-bis(2-butyloctyl)-1,4-bis(thieno[3,2-b]thiophen-5-yl)pyrrolo[3,4-c]pyrrole-3,6-dione.
| Compound Name | 2,5-bis(2-butyloctyl)-1,4-bis(thieno[3,2-b]thiophen-5-yl)pyrrolo[3,4-c]pyrrole-3,6-dione |
|---|---|
| PubChem CID | 70494392 |
| Molecular Formula | C42H56N2O2S4 |
| Molecular Weight | 749.19 g/mol |
| Exact Mass | 748.32 |
| IUPAC Name | 2,5-bis(2-butyloctyl)-1,4-bis(thieno[3,2-b]thiophen-5-yl)pyrrolo[3,4-c]pyrrole-3,6-dione |
| SMILES | CCCCCCC(CCCC)CN1C(=O)C2=C(c3cc4sccc4s3)N(CC(CCCC)CCCCCC)C(=O)C2=C1c1cc2sccc2s1 |
| InChI | InChI=1S/C42H56N2O2S4/c1-5-9-13-15-19-29(17-11-7-3)27-43-39(35-25-33-31(49-35)21-23-47-33)37-38(41(43)45)40(36-26-34-32(50-36)22-24-48-34)44(42(37)46)28-30(18-12-8-4)20-16-14-10-6-2/h21-26,29-30H,5-20,27-28H2,1-4H3 |
| InChIKey | YRCBDABVMLLGBZ-UHFFFAOYSA-N |
| XLogP | 13.60 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.19 |
| LogP ≤ 5 | 13.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|