C21H21Cl2NO4 — CID 70494643
3-(6,7-dichloro-2-cyclopentyl-1-oxo-2-propan-2-yl-3H-inden-5-yl)-4-hydroxypyrrole-2,5-dione (PubChem CID 70494643) has the molecular formula C21H21Cl2NO4 and a molecular weight of 422.31 g/mol. Its IUPAC name is 3-(6,7-dichloro-2-cyclopentyl-1-oxo-2-propan-2-yl-3H-inden-5-yl)-4-hydroxypyrrole-2,5-dione.
| Compound Name | 3-(6,7-dichloro-2-cyclopentyl-1-oxo-2-propan-2-yl-3H-inden-5-yl)-4-hydroxypyrrole-2,5-dione |
|---|---|
| PubChem CID | 70494643 |
| Molecular Formula | C21H21Cl2NO4 |
| Molecular Weight | 422.31 g/mol |
| Exact Mass | 421.08 |
| IUPAC Name | 3-(6,7-dichloro-2-cyclopentyl-1-oxo-2-propan-2-yl-3H-inden-5-yl)-4-hydroxypyrrole-2,5-dione |
| SMILES | CC(C)C1(C2CCCC2)Cc2cc(C3=C(O)C(=O)NC3=O)c(Cl)c(Cl)c2C1=O |
| InChI | InChI=1S/C21H21Cl2NO4/c1-9(2)21(11-5-3-4-6-11)8-10-7-12(14-17(25)20(28)24-19(14)27)15(22)16(23)13(10)18(21)26/h7,9,11H,3-6,8H2,1-2H3,(H2,24,25,27,28) |
| InChIKey | IKMWQNBJSUKJNB-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.31 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|