C18H18Cl2FN5S — CID 70494655
methyl N-[3,5-dichloro-4-(4,5-dihydro-1H-imidazol-2-ylamino)phenyl]-N'-[(4-fluorophenyl)methyl]carbamimidothioate (PubChem CID 70494655) has the molecular formula C18H18Cl2FN5S and a molecular weight of 426.35 g/mol. Its IUPAC name is methyl N-[3,5-dichloro-4-(4,5-dihydro-1H-imidazol-2-ylamino)phenyl]-N'-[(4-fluorophenyl)methyl]carbamimidothioate.
| Compound Name | methyl N-[3,5-dichloro-4-(4,5-dihydro-1H-imidazol-2-ylamino)phenyl]-N'-[(4-fluorophenyl)methyl]carbamimidothioate |
|---|---|
| PubChem CID | 70494655 |
| Molecular Formula | C18H18Cl2FN5S |
| Molecular Weight | 426.35 g/mol |
| Exact Mass | 425.06 |
| IUPAC Name | methyl N-[3,5-dichloro-4-(4,5-dihydro-1H-imidazol-2-ylamino)phenyl]-N'-[(4-fluorophenyl)methyl]carbamimidothioate |
| SMILES | CS/C(=N\Cc1ccc(F)cc1)Nc1cc(Cl)c(NC2=NCCN2)c(Cl)c1 |
| InChI | InChI=1S/C18H18Cl2FN5S/c1-27-18(24-10-11-2-4-12(21)5-3-11)25-13-8-14(19)16(15(20)9-13)26-17-22-6-7-23-17/h2-5,8-9H,6-7,10H2,1H3,(H,24,25)(H2,22,23,26) |
| InChIKey | NOBBUVUWCARSNE-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 60.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.35 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|