C12H10F5NO2 — CID 70495269
(4S)-6a-(2,3-difluorophenyl)-4-(trifluoromethyl)-3,3a,4,6-tetrahydro-1H-furo[3,4-c][1,2]oxazole (PubChem CID 70495269) has the molecular formula C12H10F5NO2 and a molecular weight of 295.21 g/mol. Its IUPAC name is (4S)-6a-(2,3-difluorophenyl)-4-(trifluoromethyl)-3,3a,4,6-tetrahydro-1H-furo[3,4-c][1,2]oxazole.
| Compound Name | (4S)-6a-(2,3-difluorophenyl)-4-(trifluoromethyl)-3,3a,4,6-tetrahydro-1H-furo[3,4-c][1,2]oxazole |
|---|---|
| PubChem CID | 70495269 |
| Molecular Formula | C12H10F5NO2 |
| Molecular Weight | 295.21 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | (4S)-6a-(2,3-difluorophenyl)-4-(trifluoromethyl)-3,3a,4,6-tetrahydro-1H-furo[3,4-c][1,2]oxazole |
| SMILES | Fc1cccc(C23CO[C@H](C(F)(F)F)C2CON3)c1F |
| InChI | InChI=1S/C12H10F5NO2/c13-8-3-1-2-6(9(8)14)11-5-19-10(12(15,16)17)7(11)4-20-18-11/h1-3,7,10,18H,4-5H2/t7?,10-,11?/m0/s1 |
| InChIKey | JRZUZNGKVZQBOK-QUVIFTBZSA-N |
| XLogP | 2.27 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.21 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |