C20H19FN6O3 — CID 70495358
3-[3-carbamoyl-8-(4-fluorophenyl)-4,5-dihydropyrazolo[4,3-h]quinazolin-2-yl]propylcarbamic acid (PubChem CID 70495358) has the molecular formula C20H19FN6O3 and a molecular weight of 410.41 g/mol. Its IUPAC name is 3-[3-carbamoyl-8-(4-fluorophenyl)-4,5-dihydropyrazolo[4,3-h]quinazolin-2-yl]propylcarbamic acid.
| Compound Name | 3-[3-carbamoyl-8-(4-fluorophenyl)-4,5-dihydropyrazolo[4,3-h]quinazolin-2-yl]propylcarbamic acid |
|---|---|
| PubChem CID | 70495358 |
| Molecular Formula | C20H19FN6O3 |
| Molecular Weight | 410.41 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | 3-[3-carbamoyl-8-(4-fluorophenyl)-4,5-dihydropyrazolo[4,3-h]quinazolin-2-yl]propylcarbamic acid |
| SMILES | NC(=O)c1c2c(nn1CCCNC(=O)O)-c1nc(-c3ccc(F)cc3)ncc1CC2 |
| InChI | InChI=1S/C20H19FN6O3/c21-13-5-2-11(3-6-13)19-24-10-12-4-7-14-16(15(12)25-19)26-27(17(14)18(22)28)9-1-8-23-20(29)30/h2-3,5-6,10,23H,1,4,7-9H2,(H2,22,28)(H,29,30) |
| InChIKey | UFVYOMGKYVAHCE-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 136.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.41 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|