C24H25N3O — CID 70495706
3-prop-2-enyl-2-(2,4,6-trimethylphenyl)imino-6,7-dihydropyrimido[6,1-a]isoquinolin-4-one (PubChem CID 70495706) has the molecular formula C24H25N3O and a molecular weight of 371.48 g/mol. Its IUPAC name is 3-prop-2-enyl-2-(2,4,6-trimethylphenyl)imino-6,7-dihydropyrimido[6,1-a]isoquinolin-4-one.
| Compound Name | 3-prop-2-enyl-2-(2,4,6-trimethylphenyl)imino-6,7-dihydropyrimido[6,1-a]isoquinolin-4-one |
|---|---|
| PubChem CID | 70495706 |
| Molecular Formula | C24H25N3O |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | 3-prop-2-enyl-2-(2,4,6-trimethylphenyl)imino-6,7-dihydropyrimido[6,1-a]isoquinolin-4-one |
| SMILES | C=CCn1c(=O)n2c(c/c1=N\c1c(C)cc(C)cc1C)-c1ccccc1CC2 |
| InChI | InChI=1S/C24H25N3O/c1-5-11-27-22(25-23-17(3)13-16(2)14-18(23)4)15-21-20-9-7-6-8-19(20)10-12-26(21)24(27)28/h5-9,13-15H,1,10-12H2,2-4H3/b25-22+ |
| InChIKey | KMVBLYIYUNVLNF-YYDJUVGSSA-N |
| XLogP | 4.22 |
| TPSA | 39.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|