C17H28N2O3S — CID 70495725
2-ethyl-2-(4-piperidin-3-ylsulfonylphenoxy)butan-1-amine (PubChem CID 70495725) has the molecular formula C17H28N2O3S and a molecular weight of 340.49 g/mol. Its IUPAC name is 2-ethyl-2-(4-piperidin-3-ylsulfonylphenoxy)butan-1-amine.
| Compound Name | 2-ethyl-2-(4-piperidin-3-ylsulfonylphenoxy)butan-1-amine |
|---|---|
| PubChem CID | 70495725 |
| Molecular Formula | C17H28N2O3S |
| Molecular Weight | 340.49 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | 2-ethyl-2-(4-piperidin-3-ylsulfonylphenoxy)butan-1-amine |
| SMILES | CCC(CC)(CN)Oc1ccc(S(=O)(=O)C2CCCNC2)cc1 |
| InChI | InChI=1S/C17H28N2O3S/c1-3-17(4-2,13-18)22-14-7-9-15(10-8-14)23(20,21)16-6-5-11-19-12-16/h7-10,16,19H,3-6,11-13,18H2,1-2H3 |
| InChIKey | JWUNPFRHHOGTCL-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.49 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |