C16H25NO4 — CID 70496026
methyl 3-[4-(3-amino-2-hydroxy-4-methylpentoxy)phenyl]propanoate (PubChem CID 70496026) has the molecular formula C16H25NO4 and a molecular weight of 295.38 g/mol. Its IUPAC name is methyl 3-[4-(3-amino-2-hydroxy-4-methylpentoxy)phenyl]propanoate.
| Compound Name | methyl 3-[4-(3-amino-2-hydroxy-4-methylpentoxy)phenyl]propanoate |
|---|---|
| PubChem CID | 70496026 |
| Molecular Formula | C16H25NO4 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | methyl 3-[4-(3-amino-2-hydroxy-4-methylpentoxy)phenyl]propanoate |
| SMILES | COC(=O)CCc1ccc(OCC(O)C(N)C(C)C)cc1 |
| InChI | InChI=1S/C16H25NO4/c1-11(2)16(17)14(18)10-21-13-7-4-12(5-8-13)6-9-15(19)20-3/h4-5,7-8,11,14,16,18H,6,9-10,17H2,1-3H3 |
| InChIKey | NQIKHBLKUAUGBW-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |