C24H30FN3 — CID 70496974
4-[6-[2-[4-(1-fluoropentyl)cyclohexyl]ethyl]pyridazin-3-yl]benzonitrile (PubChem CID 70496974) has the molecular formula C24H30FN3 and a molecular weight of 379.52 g/mol. Its IUPAC name is 4-[6-[2-[4-(1-fluoropentyl)cyclohexyl]ethyl]pyridazin-3-yl]benzonitrile.
| Compound Name | 4-[6-[2-[4-(1-fluoropentyl)cyclohexyl]ethyl]pyridazin-3-yl]benzonitrile |
|---|---|
| PubChem CID | 70496974 |
| Molecular Formula | C24H30FN3 |
| Molecular Weight | 379.52 g/mol |
| Exact Mass | 379.24 |
| IUPAC Name | 4-[6-[2-[4-(1-fluoropentyl)cyclohexyl]ethyl]pyridazin-3-yl]benzonitrile |
| SMILES | CCCCC(F)C1CCC(CCc2ccc(-c3ccc(C#N)cc3)nn2)CC1 |
| InChI | InChI=1S/C24H30FN3/c1-2-3-4-23(25)20-10-5-18(6-11-20)9-14-22-15-16-24(28-27-22)21-12-7-19(17-26)8-13-21/h7-8,12-13,15-16,18,20,23H,2-6,9-11,14H2,1H3 |
| InChIKey | HYZJECIIZPPYHZ-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.52 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |