About 5-chloro-3-methyl-1,4-dihydropyrido[2,3-d]pyrimidin-2-one
5-chloro-3-methyl-1,4-dihydropyrido[2,3-d]pyrimidin-2-one (PubChem CID 70497178) has the molecular formula C8H8ClN3O
and a molecular weight of 197.62 g/mol. Its IUPAC name is 5-chloro-3-methyl-1,4-dihydropyrido[2,3-d]pyrimidin-2-one.
Molecular Properties
| Compound Name | 5-chloro-3-methyl-1,4-dihydropyrido[2,3-d]pyrimidin-2-one |
| PubChem CID | 70497178 |
| Molecular Formula | C8H8ClN3O |
| Molecular Weight | 197.62 g/mol |
| Exact Mass | 197.04 |
| IUPAC Name | 5-chloro-3-methyl-1,4-dihydropyrido[2,3-d]pyrimidin-2-one |
| SMILES | CN1Cc2c(Cl)ccnc2NC1=O |
| InChI | InChI=1S/C8H8ClN3O/c1-12-4-5-6(9)2-3-10-7(5)11-8(12)13/h2-3H,4H2,1H3,(H,10,11,13) |
| InChIKey | TXCMDHRGCFZNKH-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.62 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-chloro-3-methyl-1,4-dihydropyrido[2,3-d]pyrimidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-3-methyl-1,4-dihydropyrido[2,3-d]pyrimidin-2-one?
The IUPAC name of 5-chloro-3-methyl-1,4-dihydropyrido[2,3-d]pyrimidin-2-one (CID 70497178) is 5-chloro-3-methyl-1,4-dihydropyrido[2,3-d]pyrimidin-2-one.
What is the SMILES notation for 5-chloro-3-methyl-1,4-dihydropyrido[2,3-d]pyrimidin-2-one?
The canonical SMILES for 5-chloro-3-methyl-1,4-dihydropyrido[2,3-d]pyrimidin-2-one is CN1Cc2c(Cl)ccnc2NC1=O.
What is the InChIKey of 5-chloro-3-methyl-1,4-dihydropyrido[2,3-d]pyrimidin-2-one?
The InChIKey is TXCMDHRGCFZNKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8ClN3O/c1-12-4-5-6(9)2-3-10-7(5)11-8(12)13/h2-3H,4H2,1H3,(H,10,11,13).
What are the key properties of 5-chloro-3-methyl-1,4-dihydropyrido[2,3-d]pyrimidin-2-one?
5-chloro-3-methyl-1,4-dihydropyrido[2,3-d]pyrimidin-2-one has a molecular weight of 197.62 g/mol, XLogP of 1.71, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-3-methyl-1,4-dihydropyrido[2,3-d]pyrimidin-2-one is sourced from PubChem (CID 70497178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).