C15H19FN2O — CID 70497343
N-[(1S,5R)-5-amino-1-bicyclo[3.2.1]octanyl]-3-fluorobenzamide (PubChem CID 70497343) has the molecular formula C15H19FN2O and a molecular weight of 262.33 g/mol. Its IUPAC name is N-[(1S,5R)-5-amino-1-bicyclo[3.2.1]octanyl]-3-fluorobenzamide.
| Compound Name | N-[(1S,5R)-5-amino-1-bicyclo[3.2.1]octanyl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 70497343 |
| Molecular Formula | C15H19FN2O |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | N-[(1S,5R)-5-amino-1-bicyclo[3.2.1]octanyl]-3-fluorobenzamide |
| SMILES | N[C@]12CCC[C@](NC(=O)c3cccc(F)c3)(CC1)C2 |
| InChI | InChI=1S/C15H19FN2O/c16-12-4-1-3-11(9-12)13(19)18-15-6-2-5-14(17,10-15)7-8-15/h1,3-4,9H,2,5-8,10,17H2,(H,18,19)/t14-,15+/m1/s1 |
| InChIKey | NIWAKPCNWODWLC-CABCVRRESA-N |
| XLogP | 2.36 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |