C13H17NO — CID 70497539
3-oxa-6-azatricyclo[9.4.0.02,7]pentadeca-1,12,14-triene (PubChem CID 70497539) has the molecular formula C13H17NO and a molecular weight of 203.28 g/mol. Its IUPAC name is 3-oxa-6-azatricyclo[9.4.0.02,7]pentadeca-1,12,14-triene.
| Compound Name | 3-oxa-6-azatricyclo[9.4.0.02,7]pentadeca-1,12,14-triene |
|---|---|
| PubChem CID | 70497539 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 3-oxa-6-azatricyclo[9.4.0.02,7]pentadeca-1,12,14-triene |
| SMILES | C1=CC2=C3OCCNC3CCCC2C=C1 |
| InChI | InChI=1S/C13H17NO/c1-2-6-11-10(4-1)5-3-7-12-13(11)15-9-8-14-12/h1-2,4,6,10,12,14H,3,5,7-9H2 |
| InChIKey | WIRKNPRFLDEJDM-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |