C20H30O — CID 70498001
(2S,4aR,6R,8aS)-2-butoxy-6-phenyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 70498001) has the molecular formula C20H30O and a molecular weight of 286.46 g/mol. Its IUPAC name is (2S,4aR,6R,8aS)-2-butoxy-6-phenyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | (2S,4aR,6R,8aS)-2-butoxy-6-phenyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 70498001 |
| Molecular Formula | C20H30O |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.23 |
| IUPAC Name | (2S,4aR,6R,8aS)-2-butoxy-6-phenyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | CCCCO[C@H]1CC[C@@H]2C[C@H](c3ccccc3)CC[C@H]2C1 |
| InChI | InChI=1S/C20H30O/c1-2-3-13-21-20-12-11-18-14-17(9-10-19(18)15-20)16-7-5-4-6-8-16/h4-8,17-20H,2-3,9-15H2,1H3/t17-,18-,19+,20+/m1/s1 |
| InChIKey | SFMNBNVZGUVJSX-ZRNYENFQSA-N |
| XLogP | 5.56 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|