C19H17F3O6 — CID 70498048
[4-(trifluoromethyl)phenyl]-[3-[(2R,3R,4S,5R)-2,4,5-trihydroxyoxan-3-yl]oxyphenyl]methanone (PubChem CID 70498048) has the molecular formula C19H17F3O6 and a molecular weight of 398.33 g/mol. Its IUPAC name is [4-(trifluoromethyl)phenyl]-[3-[(2R,3R,4S,5R)-2,4,5-trihydroxyoxan-3-yl]oxyphenyl]methanone.
| Compound Name | [4-(trifluoromethyl)phenyl]-[3-[(2R,3R,4S,5R)-2,4,5-trihydroxyoxan-3-yl]oxyphenyl]methanone |
|---|---|
| PubChem CID | 70498048 |
| Molecular Formula | C19H17F3O6 |
| Molecular Weight | 398.33 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | [4-(trifluoromethyl)phenyl]-[3-[(2R,3R,4S,5R)-2,4,5-trihydroxyoxan-3-yl]oxyphenyl]methanone |
| SMILES | O=C(c1ccc(C(F)(F)F)cc1)c1cccc(O[C@@H]2[C@@H](O)[C@H](O)CO[C@H]2O)c1 |
| InChI | InChI=1S/C19H17F3O6/c20-19(21,22)12-6-4-10(5-7-12)15(24)11-2-1-3-13(8-11)28-17-16(25)14(23)9-27-18(17)26/h1-8,14,16-18,23,25-26H,9H2/t14-,16+,17-,18-/m1/s1 |
| InChIKey | UJICKTMNUVADMC-BZZMCLGOSA-N |
| XLogP | 1.75 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.33 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |