About 5-methoxy-1,5-dimethyl-6-(10-methylundecyl)cyclohexa-1,3-diene
5-methoxy-1,5-dimethyl-6-(10-methylundecyl)cyclohexa-1,3-diene (PubChem CID 70498408) has the molecular formula C21H38O
and a molecular weight of 306.53 g/mol. Its IUPAC name is 5-methoxy-1,5-dimethyl-6-(10-methylundecyl)cyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 5-methoxy-1,5-dimethyl-6-(10-methylundecyl)cyclohexa-1,3-diene |
| PubChem CID | 70498408 |
| Molecular Formula | C21H38O |
| Molecular Weight | 306.53 g/mol |
| Exact Mass | 306.29 |
| IUPAC Name | 5-methoxy-1,5-dimethyl-6-(10-methylundecyl)cyclohexa-1,3-diene |
| SMILES | COC1(C)C=CC=C(C)C1CCCCCCCCCC(C)C |
| InChI | InChI=1S/C21H38O/c1-18(2)14-11-9-7-6-8-10-12-16-20-19(3)15-13-17-21(20,4)22-5/h13,15,17-18,20H,6-12,14,16H2,1-5H3 |
| InChIKey | RKHHNUKZQLYILJ-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 306.53 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-methoxy-1,5-dimethyl-6-(10-methylundecyl)cyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-1,5-dimethyl-6-(10-methylundecyl)cyclohexa-1,3-diene?
The IUPAC name of 5-methoxy-1,5-dimethyl-6-(10-methylundecyl)cyclohexa-1,3-diene (CID 70498408) is 5-methoxy-1,5-dimethyl-6-(10-methylundecyl)cyclohexa-1,3-diene.
What is the SMILES notation for 5-methoxy-1,5-dimethyl-6-(10-methylundecyl)cyclohexa-1,3-diene?
The canonical SMILES for 5-methoxy-1,5-dimethyl-6-(10-methylundecyl)cyclohexa-1,3-diene is COC1(C)C=CC=C(C)C1CCCCCCCCCC(C)C.
What is the InChIKey of 5-methoxy-1,5-dimethyl-6-(10-methylundecyl)cyclohexa-1,3-diene?
The InChIKey is RKHHNUKZQLYILJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H38O/c1-18(2)14-11-9-7-6-8-10-12-16-20-19(3)15-13-17-21(20,4)22-5/h13,15,17-18,20H,6-12,14,16H2,1-5H3.
What are the key properties of 5-methoxy-1,5-dimethyl-6-(10-methylundecyl)cyclohexa-1,3-diene?
5-methoxy-1,5-dimethyl-6-(10-methylundecyl)cyclohexa-1,3-diene has a molecular weight of 306.53 g/mol, XLogP of 6.69, 11 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-1,5-dimethyl-6-(10-methylundecyl)cyclohexa-1,3-diene is sourced from PubChem (CID 70498408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).