About 5-(3-chlorophenoxy)-3-ethyl-1,4-dihydropyrido[2,3-d]pyrimidin-2-one
5-(3-chlorophenoxy)-3-ethyl-1,4-dihydropyrido[2,3-d]pyrimidin-2-one (PubChem CID 70498650) has the molecular formula C15H14ClN3O2
and a molecular weight of 303.75 g/mol. Its IUPAC name is 5-(3-chlorophenoxy)-3-ethyl-1,4-dihydropyrido[2,3-d]pyrimidin-2-one.
Molecular Properties
| Compound Name | 5-(3-chlorophenoxy)-3-ethyl-1,4-dihydropyrido[2,3-d]pyrimidin-2-one |
| PubChem CID | 70498650 |
| Molecular Formula | C15H14ClN3O2 |
| Molecular Weight | 303.75 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | 5-(3-chlorophenoxy)-3-ethyl-1,4-dihydropyrido[2,3-d]pyrimidin-2-one |
| SMILES | CCN1Cc2c(Oc3cccc(Cl)c3)ccnc2NC1=O |
| InChI | InChI=1S/C15H14ClN3O2/c1-2-19-9-12-13(6-7-17-14(12)18-15(19)20)21-11-5-3-4-10(16)8-11/h3-8H,2,9H2,1H3,(H,17,18,20) |
| InChIKey | FVFIWHZSIQFPPM-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.75 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(3-chlorophenoxy)-3-ethyl-1,4-dihydropyrido[2,3-d]pyrimidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-chlorophenoxy)-3-ethyl-1,4-dihydropyrido[2,3-d]pyrimidin-2-one?
The IUPAC name of 5-(3-chlorophenoxy)-3-ethyl-1,4-dihydropyrido[2,3-d]pyrimidin-2-one (CID 70498650) is 5-(3-chlorophenoxy)-3-ethyl-1,4-dihydropyrido[2,3-d]pyrimidin-2-one.
What is the SMILES notation for 5-(3-chlorophenoxy)-3-ethyl-1,4-dihydropyrido[2,3-d]pyrimidin-2-one?
The canonical SMILES for 5-(3-chlorophenoxy)-3-ethyl-1,4-dihydropyrido[2,3-d]pyrimidin-2-one is CCN1Cc2c(Oc3cccc(Cl)c3)ccnc2NC1=O.
What is the InChIKey of 5-(3-chlorophenoxy)-3-ethyl-1,4-dihydropyrido[2,3-d]pyrimidin-2-one?
The InChIKey is FVFIWHZSIQFPPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14ClN3O2/c1-2-19-9-12-13(6-7-17-14(12)18-15(19)20)21-11-5-3-4-10(16)8-11/h3-8H,2,9H2,1H3,(H,17,18,20).
What are the key properties of 5-(3-chlorophenoxy)-3-ethyl-1,4-dihydropyrido[2,3-d]pyrimidin-2-one?
5-(3-chlorophenoxy)-3-ethyl-1,4-dihydropyrido[2,3-d]pyrimidin-2-one has a molecular weight of 303.75 g/mol, XLogP of 3.89, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-chlorophenoxy)-3-ethyl-1,4-dihydropyrido[2,3-d]pyrimidin-2-one is sourced from PubChem (CID 70498650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).