About 2-[3-(2-aminopropanoylamino)-2,4-dimethylphenoxy]ethyl nitrate;(Z)-but-2-enedioic acid
2-[3-(2-aminopropanoylamino)-2,4-dimethylphenoxy]ethyl nitrate;(Z)-but-2-enedioic acid (PubChem CID 70498843) has the molecular formula C17H23N3O9
and a molecular weight of 413.38 g/mol. Its IUPAC name is 2-[3-(2-aminopropanoylamino)-2,4-dimethylphenoxy]ethyl nitrate;(Z)-but-2-enedioic acid.
Molecular Properties
| Compound Name | 2-[3-(2-aminopropanoylamino)-2,4-dimethylphenoxy]ethyl nitrate;(Z)-but-2-enedioic acid |
| PubChem CID | 70498843 |
| Molecular Formula | C17H23N3O9 |
| Molecular Weight | 413.38 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | 2-[3-(2-aminopropanoylamino)-2,4-dimethylphenoxy]ethyl nitrate;(Z)-but-2-enedioic acid |
| SMILES | Cc1ccc(OCCO[N+](=O)[O-])c(C)c1NC(=O)C(C)N.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C13H19N3O5.C4H4O4/c1-8-4-5-11(20-6-7-21-16(18)19)9(2)12(8)15-13(17)10(3)14;5-3(6)1-2-4(7)8/h4-5,10H,6-7,14H2,1-3H3,(H,15,17);1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | JXKYSKRNURCCTQ-BTJKTKAUSA-N |
| XLogP | 0.89 |
| TPSA | 191.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 413.38 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-(2-aminopropanoylamino)-2,4-dimethylphenoxy]ethyl nitrate;(Z)-but-2-enedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(2-aminopropanoylamino)-2,4-dimethylphenoxy]ethyl nitrate;(Z)-but-2-enedioic acid?
The IUPAC name of 2-[3-(2-aminopropanoylamino)-2,4-dimethylphenoxy]ethyl nitrate;(Z)-but-2-enedioic acid (CID 70498843) is 2-[3-(2-aminopropanoylamino)-2,4-dimethylphenoxy]ethyl nitrate;(Z)-but-2-enedioic acid.
What is the SMILES notation for 2-[3-(2-aminopropanoylamino)-2,4-dimethylphenoxy]ethyl nitrate;(Z)-but-2-enedioic acid?
The canonical SMILES for 2-[3-(2-aminopropanoylamino)-2,4-dimethylphenoxy]ethyl nitrate;(Z)-but-2-enedioic acid is Cc1ccc(OCCO[N+](=O)[O-])c(C)c1NC(=O)C(C)N.O=C(O)/C=C\C(=O)O.
What is the InChIKey of 2-[3-(2-aminopropanoylamino)-2,4-dimethylphenoxy]ethyl nitrate;(Z)-but-2-enedioic acid?
The InChIKey is JXKYSKRNURCCTQ-BTJKTKAUSA-N. The full InChI is InChI=1S/C13H19N3O5.C4H4O4/c1-8-4-5-11(20-6-7-21-16(18)19)9(2)12(8)15-13(17)10(3)14;5-3(6)1-2-4(7)8/h4-5,10H,6-7,14H2,1-3H3,(H,15,17);1-2H,(H,5,6)(H,7,8)/b;2-1-.
What are the key properties of 2-[3-(2-aminopropanoylamino)-2,4-dimethylphenoxy]ethyl nitrate;(Z)-but-2-enedioic acid?
2-[3-(2-aminopropanoylamino)-2,4-dimethylphenoxy]ethyl nitrate;(Z)-but-2-enedioic acid has a molecular weight of 413.38 g/mol, XLogP of 0.89, 9 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(2-aminopropanoylamino)-2,4-dimethylphenoxy]ethyl nitrate;(Z)-but-2-enedioic acid is sourced from PubChem (CID 70498843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).