About 2-methyl-3,6-dimethylidenepyridine
2-methyl-3,6-dimethylidenepyridine (PubChem CID 70499080) has the molecular formula C8H9N
and a molecular weight of 119.17 g/mol. Its IUPAC name is 2-methyl-3,6-dimethylidenepyridine.
Molecular Properties
| Compound Name | 2-methyl-3,6-dimethylidenepyridine |
| PubChem CID | 70499080 |
| Molecular Formula | C8H9N |
| Molecular Weight | 119.17 g/mol |
| Exact Mass | 119.07 |
| IUPAC Name | 2-methyl-3,6-dimethylidenepyridine |
| SMILES | C=c1ccc(=C)c(C)n1 |
| InChI | InChI=1S/C8H9N/c1-6-4-5-7(2)9-8(6)3/h4-5H,1-2H2,3H3 |
| InChIKey | KARWSYKIIVHDLE-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 119.17 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-methyl-3,6-dimethylidenepyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-3,6-dimethylidenepyridine?
The IUPAC name of 2-methyl-3,6-dimethylidenepyridine (CID 70499080) is 2-methyl-3,6-dimethylidenepyridine.
What is the SMILES notation for 2-methyl-3,6-dimethylidenepyridine?
The canonical SMILES for 2-methyl-3,6-dimethylidenepyridine is C=c1ccc(=C)c(C)n1.
What is the InChIKey of 2-methyl-3,6-dimethylidenepyridine?
The InChIKey is KARWSYKIIVHDLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N/c1-6-4-5-7(2)9-8(6)3/h4-5H,1-2H2,3H3.
What are the key properties of 2-methyl-3,6-dimethylidenepyridine?
2-methyl-3,6-dimethylidenepyridine has a molecular weight of 119.17 g/mol, XLogP of 0.21, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-3,6-dimethylidenepyridine is sourced from PubChem (CID 70499080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).