About 2-[1-(4-fluorophenyl)-3-methoxynaphthalen-2-yl]-4,4-dimethyl-5H-1,3-oxazole
2-[1-(4-fluorophenyl)-3-methoxynaphthalen-2-yl]-4,4-dimethyl-5H-1,3-oxazole (PubChem CID 70499286) has the molecular formula C22H20FNO2
and a molecular weight of 349.41 g/mol. Its IUPAC name is 2-[1-(4-fluorophenyl)-3-methoxynaphthalen-2-yl]-4,4-dimethyl-5H-1,3-oxazole.
Molecular Properties
| Compound Name | 2-[1-(4-fluorophenyl)-3-methoxynaphthalen-2-yl]-4,4-dimethyl-5H-1,3-oxazole |
| PubChem CID | 70499286 |
| Molecular Formula | C22H20FNO2 |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | 2-[1-(4-fluorophenyl)-3-methoxynaphthalen-2-yl]-4,4-dimethyl-5H-1,3-oxazole |
| SMILES | COc1cc2ccccc2c(-c2ccc(F)cc2)c1C1=NC(C)(C)CO1 |
| InChI | InChI=1S/C22H20FNO2/c1-22(2)13-26-21(24-22)20-18(25-3)12-15-6-4-5-7-17(15)19(20)14-8-10-16(23)11-9-14/h4-12H,13H2,1-3H3 |
| InChIKey | PVBQBYGISPRJRH-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[1-(4-fluorophenyl)-3-methoxynaphthalen-2-yl]-4,4-dimethyl-5H-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(4-fluorophenyl)-3-methoxynaphthalen-2-yl]-4,4-dimethyl-5H-1,3-oxazole?
The IUPAC name of 2-[1-(4-fluorophenyl)-3-methoxynaphthalen-2-yl]-4,4-dimethyl-5H-1,3-oxazole (CID 70499286) is 2-[1-(4-fluorophenyl)-3-methoxynaphthalen-2-yl]-4,4-dimethyl-5H-1,3-oxazole.
What is the SMILES notation for 2-[1-(4-fluorophenyl)-3-methoxynaphthalen-2-yl]-4,4-dimethyl-5H-1,3-oxazole?
The canonical SMILES for 2-[1-(4-fluorophenyl)-3-methoxynaphthalen-2-yl]-4,4-dimethyl-5H-1,3-oxazole is COc1cc2ccccc2c(-c2ccc(F)cc2)c1C1=NC(C)(C)CO1.
What is the InChIKey of 2-[1-(4-fluorophenyl)-3-methoxynaphthalen-2-yl]-4,4-dimethyl-5H-1,3-oxazole?
The InChIKey is PVBQBYGISPRJRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20FNO2/c1-22(2)13-26-21(24-22)20-18(25-3)12-15-6-4-5-7-17(15)19(20)14-8-10-16(23)11-9-14/h4-12H,13H2,1-3H3.
What are the key properties of 2-[1-(4-fluorophenyl)-3-methoxynaphthalen-2-yl]-4,4-dimethyl-5H-1,3-oxazole?
2-[1-(4-fluorophenyl)-3-methoxynaphthalen-2-yl]-4,4-dimethyl-5H-1,3-oxazole has a molecular weight of 349.41 g/mol, XLogP of 5.21, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(4-fluorophenyl)-3-methoxynaphthalen-2-yl]-4,4-dimethyl-5H-1,3-oxazole is sourced from PubChem (CID 70499286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).