About ethanamine;triazolo[4,5-i][1,2]benzodiazepine
ethanamine;triazolo[4,5-i][1,2]benzodiazepine (PubChem CID 70499316) has the molecular formula C11H12N6
and a molecular weight of 228.26 g/mol. Its IUPAC name is ethanamine;triazolo[4,5-i][1,2]benzodiazepine.
Molecular Properties
| Compound Name | ethanamine;triazolo[4,5-i][1,2]benzodiazepine |
| PubChem CID | 70499316 |
| Molecular Formula | C11H12N6 |
| Molecular Weight | 228.26 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | ethanamine;triazolo[4,5-i][1,2]benzodiazepine |
| SMILES | CCN.c1cnnc2c(c1)ccc1nnnc12 |
| InChI | InChI=1S/C9H5N5.C2H7N/c1-2-6-3-4-7-9(13-14-11-7)8(6)12-10-5-1;1-2-3/h1-5H;2-3H2,1H3 |
| InChIKey | SZMLEOBMHOMREV-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 90.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.26 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethanamine;triazolo[4,5-i][1,2]benzodiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanamine;triazolo[4,5-i][1,2]benzodiazepine?
The IUPAC name of ethanamine;triazolo[4,5-i][1,2]benzodiazepine (CID 70499316) is ethanamine;triazolo[4,5-i][1,2]benzodiazepine.
What is the SMILES notation for ethanamine;triazolo[4,5-i][1,2]benzodiazepine?
The canonical SMILES for ethanamine;triazolo[4,5-i][1,2]benzodiazepine is CCN.c1cnnc2c(c1)ccc1nnnc12.
What is the InChIKey of ethanamine;triazolo[4,5-i][1,2]benzodiazepine?
The InChIKey is SZMLEOBMHOMREV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5N5.C2H7N/c1-2-6-3-4-7-9(13-14-11-7)8(6)12-10-5-1;1-2-3/h1-5H;2-3H2,1H3.
What are the key properties of ethanamine;triazolo[4,5-i][1,2]benzodiazepine?
ethanamine;triazolo[4,5-i][1,2]benzodiazepine has a molecular weight of 228.26 g/mol, XLogP of 0.93, 0 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethanamine;triazolo[4,5-i][1,2]benzodiazepine is sourced from PubChem (CID 70499316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).