C34H48O3 — CID 70499390
methyl [1-pentyl-4-[4-[4-(4-propylcyclohexyl)phenyl]phenyl]cyclohexyl] carbonate (PubChem CID 70499390) has the molecular formula C34H48O3 and a molecular weight of 504.76 g/mol. Its IUPAC name is methyl [1-pentyl-4-[4-[4-(4-propylcyclohexyl)phenyl]phenyl]cyclohexyl] carbonate.
| Compound Name | methyl [1-pentyl-4-[4-[4-(4-propylcyclohexyl)phenyl]phenyl]cyclohexyl] carbonate |
|---|---|
| PubChem CID | 70499390 |
| Molecular Formula | C34H48O3 |
| Molecular Weight | 504.76 g/mol |
| Exact Mass | 504.36 |
| IUPAC Name | methyl [1-pentyl-4-[4-[4-(4-propylcyclohexyl)phenyl]phenyl]cyclohexyl] carbonate |
| SMILES | CCCCCC1(OC(=O)OC)CCC(c2ccc(-c3ccc(C4CCC(CCC)CC4)cc3)cc2)CC1 |
| InChI | InChI=1S/C34H48O3/c1-4-6-7-23-34(37-33(35)36-3)24-21-32(22-25-34)31-19-17-30(18-20-31)29-15-13-28(14-16-29)27-11-9-26(8-5-2)10-12-27/h13-20,26-27,32H,4-12,21-25H2,1-3H3 |
| InChIKey | DGUUYARFYDBLRD-UHFFFAOYSA-N |
| XLogP | 10.19 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.76 |
| LogP ≤ 5 | 10.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|