C16H28N2 — CID 70499445
3-cyclonon-3-en-1-yl-2,4,5,6,7,8-hexahydro-1,3-diazonine (PubChem CID 70499445) has the molecular formula C16H28N2 and a molecular weight of 248.41 g/mol. Its IUPAC name is 3-cyclonon-3-en-1-yl-2,4,5,6,7,8-hexahydro-1,3-diazonine.
| Compound Name | 3-cyclonon-3-en-1-yl-2,4,5,6,7,8-hexahydro-1,3-diazonine |
|---|---|
| PubChem CID | 70499445 |
| Molecular Formula | C16H28N2 |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.23 |
| IUPAC Name | 3-cyclonon-3-en-1-yl-2,4,5,6,7,8-hexahydro-1,3-diazonine |
| SMILES | C1=CCC(N2CCCCCC=NC2)CCCCC1 |
| InChI | InChI=1S/C16H28N2/c1-2-4-8-12-16(11-7-3-1)18-14-10-6-5-9-13-17-15-18/h3,7,13,16H,1-2,4-6,8-12,14-15H2 |
| InChIKey | NXSRLCVOWMILOD-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|