C12H14O8 — CID 70499473
2-(carboxymethyl)bicyclo[2.2.1]heptane-2,3,5-tricarboxylic acid (PubChem CID 70499473) has the molecular formula C12H14O8 and a molecular weight of 286.24 g/mol. Its IUPAC name is 2-(carboxymethyl)bicyclo[2.2.1]heptane-2,3,5-tricarboxylic acid.
| Compound Name | 2-(carboxymethyl)bicyclo[2.2.1]heptane-2,3,5-tricarboxylic acid |
|---|---|
| PubChem CID | 70499473 |
| Molecular Formula | C12H14O8 |
| Molecular Weight | 286.24 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | 2-(carboxymethyl)bicyclo[2.2.1]heptane-2,3,5-tricarboxylic acid |
| SMILES | O=C(O)CC1(C(=O)O)C2CC(C(=O)O)C(C2)C1C(=O)O |
| InChI | InChI=1S/C12H14O8/c13-7(14)3-12(11(19)20)4-1-5(8(12)10(17)18)6(2-4)9(15)16/h4-6,8H,1-3H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20) |
| InChIKey | FTEKIFWPVIMOJE-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.24 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |