C14H13NO — CID 70499730
(6Z,12Z)-10a,11-dihydro-4aH-benzo[c][1,5]benzoxazocine (PubChem CID 70499730) has the molecular formula C14H13NO and a molecular weight of 211.26 g/mol. Its IUPAC name is (6Z,12Z)-10a,11-dihydro-4aH-benzo[c][1,5]benzoxazocine.
| Compound Name | (6Z,12Z)-10a,11-dihydro-4aH-benzo[c][1,5]benzoxazocine |
|---|---|
| PubChem CID | 70499730 |
| Molecular Formula | C14H13NO |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | (6Z,12Z)-10a,11-dihydro-4aH-benzo[c][1,5]benzoxazocine |
| SMILES | C1=C/C2=C/OC3C=CC=C/C3=C/NC2C=C1 |
| InChI | InChI=1S/C14H13NO/c1-3-7-13-12(6-1)10-16-14-8-4-2-5-11(14)9-15-13/h1-10,13-15H/b11-9-,12-10- |
| InChIKey | WLIBRHGVLQNVPK-HWAYABPNSA-N |
| XLogP | 2.36 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |