About (7S)-2-oxa-3-azatricyclo[5.3.1.03,8]undecane
(7S)-2-oxa-3-azatricyclo[5.3.1.03,8]undecane (PubChem CID 70500131) has the molecular formula C9H15NO
and a molecular weight of 153.22 g/mol. Its IUPAC name is (7S)-2-oxa-3-azatricyclo[5.3.1.03,8]undecane.
Molecular Properties
| Compound Name | (7S)-2-oxa-3-azatricyclo[5.3.1.03,8]undecane |
| PubChem CID | 70500131 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | (7S)-2-oxa-3-azatricyclo[5.3.1.03,8]undecane |
| SMILES | C1C[C@H]2CC3CCC2N(C1)O3 |
| InChI | InChI=1S/C9H15NO/c1-2-7-6-8-3-4-9(7)10(5-1)11-8/h7-9H,1-6H2/t7-,8?,9?/m0/s1 |
| InChIKey | IIVOPVKXGDXTJD-UEJVZZJDSA-N |
| XLogP | 1.56 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (7S)-2-oxa-3-azatricyclo[5.3.1.03,8]undecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7S)-2-oxa-3-azatricyclo[5.3.1.03,8]undecane?
The IUPAC name of (7S)-2-oxa-3-azatricyclo[5.3.1.03,8]undecane (CID 70500131) is (7S)-2-oxa-3-azatricyclo[5.3.1.03,8]undecane.
What is the SMILES notation for (7S)-2-oxa-3-azatricyclo[5.3.1.03,8]undecane?
The canonical SMILES for (7S)-2-oxa-3-azatricyclo[5.3.1.03,8]undecane is C1C[C@H]2CC3CCC2N(C1)O3.
What is the InChIKey of (7S)-2-oxa-3-azatricyclo[5.3.1.03,8]undecane?
The InChIKey is IIVOPVKXGDXTJD-UEJVZZJDSA-N. The full InChI is InChI=1S/C9H15NO/c1-2-7-6-8-3-4-9(7)10(5-1)11-8/h7-9H,1-6H2/t7-,8?,9?/m0/s1.
What are the key properties of (7S)-2-oxa-3-azatricyclo[5.3.1.03,8]undecane?
(7S)-2-oxa-3-azatricyclo[5.3.1.03,8]undecane has a molecular weight of 153.22 g/mol, XLogP of 1.56, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (7S)-2-oxa-3-azatricyclo[5.3.1.03,8]undecane is sourced from PubChem (CID 70500131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).