About (5S,6R)-6-(6-chloro-1,3-benzodioxol-5-yl)-5-nitropiperidin-2-one
(5S,6R)-6-(6-chloro-1,3-benzodioxol-5-yl)-5-nitropiperidin-2-one (PubChem CID 705005) has the molecular formula C12H11ClN2O5
and a molecular weight of 298.68 g/mol. Its IUPAC name is (5S,6R)-6-(6-chloro-1,3-benzodioxol-5-yl)-5-nitropiperidin-2-one.
Molecular Properties
| Compound Name | (5S,6R)-6-(6-chloro-1,3-benzodioxol-5-yl)-5-nitropiperidin-2-one |
| PubChem CID | 705005 |
| Molecular Formula | C12H11ClN2O5 |
| Molecular Weight | 298.68 g/mol |
| Exact Mass | 298.04 |
| IUPAC Name | (5S,6R)-6-(6-chloro-1,3-benzodioxol-5-yl)-5-nitropiperidin-2-one |
| SMILES | O=C1CC[C@H]([N+](=O)[O-])[C@@H](c2cc3c(cc2Cl)OCO3)N1 |
| InChI | InChI=1S/C12H11ClN2O5/c13-7-4-10-9(19-5-20-10)3-6(7)12-8(15(17)18)1-2-11(16)14-12/h3-4,8,12H,1-2,5H2,(H,14,16)/t8-,12+/m0/s1 |
| InChIKey | ISQNUCJEUYXRGA-QPUJVOFHSA-N |
| XLogP | 1.67 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.68 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (5S,6R)-6-(6-chloro-1,3-benzodioxol-5-yl)-5-nitropiperidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S,6R)-6-(6-chloro-1,3-benzodioxol-5-yl)-5-nitropiperidin-2-one?
The IUPAC name of (5S,6R)-6-(6-chloro-1,3-benzodioxol-5-yl)-5-nitropiperidin-2-one (CID 705005) is (5S,6R)-6-(6-chloro-1,3-benzodioxol-5-yl)-5-nitropiperidin-2-one.
What is the SMILES notation for (5S,6R)-6-(6-chloro-1,3-benzodioxol-5-yl)-5-nitropiperidin-2-one?
The canonical SMILES for (5S,6R)-6-(6-chloro-1,3-benzodioxol-5-yl)-5-nitropiperidin-2-one is O=C1CC[C@H]([N+](=O)[O-])[C@@H](c2cc3c(cc2Cl)OCO3)N1.
What is the InChIKey of (5S,6R)-6-(6-chloro-1,3-benzodioxol-5-yl)-5-nitropiperidin-2-one?
The InChIKey is ISQNUCJEUYXRGA-QPUJVOFHSA-N. The full InChI is InChI=1S/C12H11ClN2O5/c13-7-4-10-9(19-5-20-10)3-6(7)12-8(15(17)18)1-2-11(16)14-12/h3-4,8,12H,1-2,5H2,(H,14,16)/t8-,12+/m0/s1.
What are the key properties of (5S,6R)-6-(6-chloro-1,3-benzodioxol-5-yl)-5-nitropiperidin-2-one?
(5S,6R)-6-(6-chloro-1,3-benzodioxol-5-yl)-5-nitropiperidin-2-one has a molecular weight of 298.68 g/mol, XLogP of 1.67, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5S,6R)-6-(6-chloro-1,3-benzodioxol-5-yl)-5-nitropiperidin-2-one is sourced from PubChem (CID 705005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).