C36H43NO13S — CID 70500578
[3-[1-(cyclobutylamino)-2-hydroxyethyl]-5-[4-(2,2-dimethylpropanoyloxy)benzoyl]oxyphenyl] 4-(2,2-dimethylpropanoyloxy)benzoate;sulfuric acid (PubChem CID 70500578) has the molecular formula C36H43NO13S and a molecular weight of 729.80 g/mol. Its IUPAC name is [3-[1-(cyclobutylamino)-2-hydroxyethyl]-5-[4-(2,2-dimethylpropanoyloxy)benzoyl]oxyphenyl] 4-(2,2-dimethylpropanoyloxy)benzoate;sulfuric acid.
| Compound Name | [3-[1-(cyclobutylamino)-2-hydroxyethyl]-5-[4-(2,2-dimethylpropanoyloxy)benzoyl]oxyphenyl] 4-(2,2-dimethylpropanoyloxy)benzoate;sulfuric acid |
|---|---|
| PubChem CID | 70500578 |
| Molecular Formula | C36H43NO13S |
| Molecular Weight | 729.80 g/mol |
| Exact Mass | 729.25 |
| IUPAC Name | [3-[1-(cyclobutylamino)-2-hydroxyethyl]-5-[4-(2,2-dimethylpropanoyloxy)benzoyl]oxyphenyl] 4-(2,2-dimethylpropanoyloxy)benzoate;sulfuric acid |
| SMILES | CC(C)(C)C(=O)Oc1ccc(C(=O)Oc2cc(OC(=O)c3ccc(OC(=O)C(C)(C)C)cc3)cc(C(CO)NC3CCC3)c2)cc1.O=S(=O)(O)O |
| InChI | InChI=1S/C36H41NO9.H2O4S/c1-35(2,3)33(41)45-26-14-10-22(11-15-26)31(39)43-28-18-24(30(21-38)37-25-8-7-9-25)19-29(20-28)44-32(40)23-12-16-27(17-13-23)46-34(42)36(4,5)6;1-5(2,3)4/h10-20,25,30,37-38H,7-9,21H2,1-6H3;(H2,1,2,3,4) |
| InChIKey | QEOBYEJUPIEPNW-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 212.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.80 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|