C6H11N5 — CID 70500672
2-N,4-N-dimethylpyrimidine-2,4,6-triamine (PubChem CID 70500672) has the molecular formula C6H11N5 and a molecular weight of 153.19 g/mol. Its IUPAC name is 2-N,4-N-dimethylpyrimidine-2,4,6-triamine.
| Compound Name | 2-N,4-N-dimethylpyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 70500672 |
| Molecular Formula | C6H11N5 |
| Molecular Weight | 153.19 g/mol |
| Exact Mass | 153.10 |
| IUPAC Name | 2-N,4-N-dimethylpyrimidine-2,4,6-triamine |
| SMILES | CNc1cc(N)nc(NC)n1 |
| InChI | InChI=1S/C6H11N5/c1-8-5-3-4(7)10-6(9-2)11-5/h3H,1-2H3,(H4,7,8,9,10,11) |
| InChIKey | RPIJCORZADUHLU-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.19 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |