C19H28O4 — CID 70500899
3,9-di(cyclohexen-1-yl)-2,4,8,10-tetraoxaspiro[5.5]undecane (PubChem CID 70500899) has the molecular formula C19H28O4 and a molecular weight of 320.43 g/mol. Its IUPAC name is 3,9-di(cyclohexen-1-yl)-2,4,8,10-tetraoxaspiro[5.5]undecane.
| Compound Name | 3,9-di(cyclohexen-1-yl)-2,4,8,10-tetraoxaspiro[5.5]undecane |
|---|---|
| PubChem CID | 70500899 |
| Molecular Formula | C19H28O4 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | 3,9-di(cyclohexen-1-yl)-2,4,8,10-tetraoxaspiro[5.5]undecane |
| SMILES | C1=C(C2OCC3(CO2)COC(C2=CCCCC2)OC3)CCCC1 |
| InChI | InChI=1S/C19H28O4/c1-3-7-15(8-4-1)17-20-11-19(12-21-17)13-22-18(23-14-19)16-9-5-2-6-10-16/h7,9,17-18H,1-6,8,10-14H2 |
| InChIKey | LWTWLZWSIGRJPF-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|