C19H21N3OS — CID 70501055
19-methyl-8-thia-15,19,22-triazapentacyclo[11.7.2.02,7.09,22.017,21]docosa-2,4,6,9,11-pentaen-14-one (PubChem CID 70501055) has the molecular formula C19H21N3OS and a molecular weight of 339.46 g/mol. Its IUPAC name is 19-methyl-8-thia-15,19,22-triazapentacyclo[11.7.2.02,7.09,22.017,21]docosa-2,4,6,9,11-pentaen-14-one.
| Compound Name | 19-methyl-8-thia-15,19,22-triazapentacyclo[11.7.2.02,7.09,22.017,21]docosa-2,4,6,9,11-pentaen-14-one |
|---|---|
| PubChem CID | 70501055 |
| Molecular Formula | C19H21N3OS |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | 19-methyl-8-thia-15,19,22-triazapentacyclo[11.7.2.02,7.09,22.017,21]docosa-2,4,6,9,11-pentaen-14-one |
| SMILES | CN1CC2CNC(=O)C3C=CC=C4Sc5ccccc5C(C1)C2N43 |
| InChI | InChI=1S/C19H21N3OS/c1-21-10-12-9-20-19(23)15-6-4-8-17-22(15)18(12)14(11-21)13-5-2-3-7-16(13)24-17/h2-8,12,14-15,18H,9-11H2,1H3,(H,20,23) |
| InChIKey | JCXFSWGMNFFRHX-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |