About 2-(dimethylamino)-N,2-dimethylcyclopropane-1-carboxamide
2-(dimethylamino)-N,2-dimethylcyclopropane-1-carboxamide (PubChem CID 70501157) has the molecular formula C8H16N2O
and a molecular weight of 156.23 g/mol. Its IUPAC name is 2-(dimethylamino)-N,2-dimethylcyclopropane-1-carboxamide.
Molecular Properties
| Compound Name | 2-(dimethylamino)-N,2-dimethylcyclopropane-1-carboxamide |
| PubChem CID | 70501157 |
| Molecular Formula | C8H16N2O |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.13 |
| IUPAC Name | 2-(dimethylamino)-N,2-dimethylcyclopropane-1-carboxamide |
| SMILES | CNC(=O)C1CC1(C)N(C)C |
| InChI | InChI=1S/C8H16N2O/c1-8(10(3)4)5-6(8)7(11)9-2/h6H,5H2,1-4H3,(H,9,11) |
| InChIKey | XGSLPTYSFSHLGK-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(dimethylamino)-N,2-dimethylcyclopropane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethylamino)-N,2-dimethylcyclopropane-1-carboxamide?
The IUPAC name of 2-(dimethylamino)-N,2-dimethylcyclopropane-1-carboxamide (CID 70501157) is 2-(dimethylamino)-N,2-dimethylcyclopropane-1-carboxamide.
What is the SMILES notation for 2-(dimethylamino)-N,2-dimethylcyclopropane-1-carboxamide?
The canonical SMILES for 2-(dimethylamino)-N,2-dimethylcyclopropane-1-carboxamide is CNC(=O)C1CC1(C)N(C)C.
What is the InChIKey of 2-(dimethylamino)-N,2-dimethylcyclopropane-1-carboxamide?
The InChIKey is XGSLPTYSFSHLGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2O/c1-8(10(3)4)5-6(8)7(11)9-2/h6H,5H2,1-4H3,(H,9,11).
What are the key properties of 2-(dimethylamino)-N,2-dimethylcyclopropane-1-carboxamide?
2-(dimethylamino)-N,2-dimethylcyclopropane-1-carboxamide has a molecular weight of 156.23 g/mol, XLogP of 0.07, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)-N,2-dimethylcyclopropane-1-carboxamide is sourced from PubChem (CID 70501157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).