C20H37NO — CID 70501280
4-[3-[(1S,6R)-6-tert-butylcyclohex-2-en-1-yl]-2-methylpropyl]-2,6-dimethylmorpholine (PubChem CID 70501280) has the molecular formula C20H37NO and a molecular weight of 307.52 g/mol. Its IUPAC name is 4-[3-[(1S,6R)-6-tert-butylcyclohex-2-en-1-yl]-2-methylpropyl]-2,6-dimethylmorpholine.
| Compound Name | 4-[3-[(1S,6R)-6-tert-butylcyclohex-2-en-1-yl]-2-methylpropyl]-2,6-dimethylmorpholine |
|---|---|
| PubChem CID | 70501280 |
| Molecular Formula | C20H37NO |
| Molecular Weight | 307.52 g/mol |
| Exact Mass | 307.29 |
| IUPAC Name | 4-[3-[(1S,6R)-6-tert-butylcyclohex-2-en-1-yl]-2-methylpropyl]-2,6-dimethylmorpholine |
| SMILES | CC(C[C@H]1C=CCC[C@H]1C(C)(C)C)CN1CC(C)OC(C)C1 |
| InChI | InChI=1S/C20H37NO/c1-15(12-21-13-16(2)22-17(3)14-21)11-18-9-7-8-10-19(18)20(4,5)6/h7,9,15-19H,8,10-14H2,1-6H3/t15?,16?,17?,18-,19-/m1/s1 |
| InChIKey | FCKVXRNTSAVXJH-UNBAIFSFSA-N |
| XLogP | 4.75 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.52 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|