C8H13N7S2 — CID 70501422
4-N-methyl-3-N-[2-(1H-1,2,4-triazol-5-ylmethylsulfanyl)ethyl]-1,2,5-thiadiazole-3,4-diamine (PubChem CID 70501422) has the molecular formula C8H13N7S2 and a molecular weight of 271.37 g/mol. Its IUPAC name is 4-N-methyl-3-N-[2-(1H-1,2,4-triazol-5-ylmethylsulfanyl)ethyl]-1,2,5-thiadiazole-3,4-diamine.
| Compound Name | 4-N-methyl-3-N-[2-(1H-1,2,4-triazol-5-ylmethylsulfanyl)ethyl]-1,2,5-thiadiazole-3,4-diamine |
|---|---|
| PubChem CID | 70501422 |
| Molecular Formula | C8H13N7S2 |
| Molecular Weight | 271.37 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | 4-N-methyl-3-N-[2-(1H-1,2,4-triazol-5-ylmethylsulfanyl)ethyl]-1,2,5-thiadiazole-3,4-diamine |
| SMILES | CNc1nsnc1NCCSCc1ncn[nH]1 |
| InChI | InChI=1S/C8H13N7S2/c1-9-7-8(15-17-14-7)10-2-3-16-4-6-11-5-12-13-6/h5H,2-4H2,1H3,(H,9,14)(H,10,15)(H,11,12,13) |
| InChIKey | DRTZBDLAXKJVCF-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 91.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.37 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|