About benzo[a]phenalen-7-one;2-[bis(2-hydroxyethyl)amino]ethanol
benzo[a]phenalen-7-one;2-[bis(2-hydroxyethyl)amino]ethanol (PubChem CID 70501506) has the molecular formula C23H25NO4
and a molecular weight of 379.46 g/mol. Its IUPAC name is benzo[a]phenalen-7-one;2-[bis(2-hydroxyethyl)amino]ethanol.
Molecular Properties
| Compound Name | benzo[a]phenalen-7-one;2-[bis(2-hydroxyethyl)amino]ethanol |
| PubChem CID | 70501506 |
| Molecular Formula | C23H25NO4 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | benzo[a]phenalen-7-one;2-[bis(2-hydroxyethyl)amino]ethanol |
| SMILES | O=C1c2ccccc2-c2cccc3cccc1c23.OCCN(CCO)CCO |
| InChI | InChI=1S/C17H10O.C6H15NO3/c18-17-14-8-2-1-7-12(14)13-9-3-5-11-6-4-10-15(17)16(11)13;8-4-1-7(2-5-9)3-6-10/h1-10H;8-10H,1-6H2 |
| InChIKey | TYVQVKZTRVHSJQ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze benzo[a]phenalen-7-one;2-[bis(2-hydroxyethyl)amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzo[a]phenalen-7-one;2-[bis(2-hydroxyethyl)amino]ethanol?
The IUPAC name of benzo[a]phenalen-7-one;2-[bis(2-hydroxyethyl)amino]ethanol (CID 70501506) is benzo[a]phenalen-7-one;2-[bis(2-hydroxyethyl)amino]ethanol.
What is the SMILES notation for benzo[a]phenalen-7-one;2-[bis(2-hydroxyethyl)amino]ethanol?
The canonical SMILES for benzo[a]phenalen-7-one;2-[bis(2-hydroxyethyl)amino]ethanol is O=C1c2ccccc2-c2cccc3cccc1c23.OCCN(CCO)CCO.
What is the InChIKey of benzo[a]phenalen-7-one;2-[bis(2-hydroxyethyl)amino]ethanol?
The InChIKey is TYVQVKZTRVHSJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H10O.C6H15NO3/c18-17-14-8-2-1-7-12(14)13-9-3-5-11-6-4-10-15(17)16(11)13;8-4-1-7(2-5-9)3-6-10/h1-10H;8-10H,1-6H2.
What are the key properties of benzo[a]phenalen-7-one;2-[bis(2-hydroxyethyl)amino]ethanol?
benzo[a]phenalen-7-one;2-[bis(2-hydroxyethyl)amino]ethanol has a molecular weight of 379.46 g/mol, XLogP of 2.32, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzo[a]phenalen-7-one;2-[bis(2-hydroxyethyl)amino]ethanol is sourced from PubChem (CID 70501506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).