About 2-(2-hydroxyethoxy)ethanol;1-methylcyclohexane-1,2-dicarboxylic acid
2-(2-hydroxyethoxy)ethanol;1-methylcyclohexane-1,2-dicarboxylic acid (PubChem CID 70501702) has the molecular formula C13H24O7
and a molecular weight of 292.33 g/mol. Its IUPAC name is 2-(2-hydroxyethoxy)ethanol;1-methylcyclohexane-1,2-dicarboxylic acid.
Molecular Properties
| Compound Name | 2-(2-hydroxyethoxy)ethanol;1-methylcyclohexane-1,2-dicarboxylic acid |
| PubChem CID | 70501702 |
| Molecular Formula | C13H24O7 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | 2-(2-hydroxyethoxy)ethanol;1-methylcyclohexane-1,2-dicarboxylic acid |
| SMILES | CC1(C(=O)O)CCCCC1C(=O)O.OCCOCCO |
| InChI | InChI=1S/C9H14O4.C4H10O3/c1-9(8(12)13)5-3-2-4-6(9)7(10)11;5-1-3-7-4-2-6/h6H,2-5H2,1H3,(H,10,11)(H,12,13);5-6H,1-4H2 |
| InChIKey | ZNUBRLIONCVSFM-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-hydroxyethoxy)ethanol;1-methylcyclohexane-1,2-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-hydroxyethoxy)ethanol;1-methylcyclohexane-1,2-dicarboxylic acid?
The IUPAC name of 2-(2-hydroxyethoxy)ethanol;1-methylcyclohexane-1,2-dicarboxylic acid (CID 70501702) is 2-(2-hydroxyethoxy)ethanol;1-methylcyclohexane-1,2-dicarboxylic acid.
What is the SMILES notation for 2-(2-hydroxyethoxy)ethanol;1-methylcyclohexane-1,2-dicarboxylic acid?
The canonical SMILES for 2-(2-hydroxyethoxy)ethanol;1-methylcyclohexane-1,2-dicarboxylic acid is CC1(C(=O)O)CCCCC1C(=O)O.OCCOCCO.
What is the InChIKey of 2-(2-hydroxyethoxy)ethanol;1-methylcyclohexane-1,2-dicarboxylic acid?
The InChIKey is ZNUBRLIONCVSFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O4.C4H10O3/c1-9(8(12)13)5-3-2-4-6(9)7(10)11;5-1-3-7-4-2-6/h6H,2-5H2,1H3,(H,10,11)(H,12,13);5-6H,1-4H2.
What are the key properties of 2-(2-hydroxyethoxy)ethanol;1-methylcyclohexane-1,2-dicarboxylic acid?
2-(2-hydroxyethoxy)ethanol;1-methylcyclohexane-1,2-dicarboxylic acid has a molecular weight of 292.33 g/mol, XLogP of 0.34, 6 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-hydroxyethoxy)ethanol;1-methylcyclohexane-1,2-dicarboxylic acid is sourced from PubChem (CID 70501702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).